C27H32N2O4S — CID 54527218
(2S,3S)-3-methyl-2-(naphthalen-1-ylsulfonylamino)-N-[(2R)-5-oxo-1-phenylpentan-2-yl]pentanamide (PubChem CID 54527218) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(naphthalen-1-ylsulfonylamino)-N-[(2R)-5-oxo-1-phenylpentan-2-yl]pentanamide.
| Compound Name | (2S,3S)-3-methyl-2-(naphthalen-1-ylsulfonylamino)-N-[(2R)-5-oxo-1-phenylpentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54527218 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (2S,3S)-3-methyl-2-(naphthalen-1-ylsulfonylamino)-N-[(2R)-5-oxo-1-phenylpentan-2-yl]pentanamide |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)c1cccc2ccccc12)C(=O)N[C@H](CCC=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O4S/c1-3-20(2)26(27(31)28-23(15-10-18-30)19-21-11-5-4-6-12-21)29-34(32,33)25-17-9-14-22-13-7-8-16-24(22)25/h4-9,11-14,16-18,20,23,26,29H,3,10,15,19H2,1-2H3,(H,28,31)/t20-,23+,26-/m0/s1 |
| InChIKey | YTZBNNFITQSWGO-CLLDFNAGSA-N |
| XLogP | 4.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|