About N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 102697459) has the molecular formula C8H13N3O5S
and a molecular weight of 263.27 g/mol. Its IUPAC name is N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 102697459 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O5S/c1-5(16-2)3-10-17(14,15)6-4-9-8(13)11-7(6)12/h4-5,10H,3H2,1-2H3,(H2,9,11,12,13) |
| InChIKey | MEAZGBZVPWTVDM-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 102697459) is N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide is COC(C)CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is MEAZGBZVPWTVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O5S/c1-5(16-2)3-10-17(14,15)6-4-9-8(13)11-7(6)12/h4-5,10H,3H2,1-2H3,(H2,9,11,12,13).
What are the key properties of N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 263.27 g/mol, XLogP of -1.62, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxypropyl)-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 102697459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).