C11H19N5O — CID 102698434
3-(2-methoxypropylamino)-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 102698434) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-(2-methoxypropylamino)-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-(2-methoxypropylamino)-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 102698434 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-(2-methoxypropylamino)-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(NCC(C)OC)nnc(C)c1C |
| InChI | InChI=1S/C11H19N5O/c1-6(17-4)5-14-11-9(10(12)13)7(2)8(3)15-16-11/h6H,5H2,1-4H3,(H3,12,13)(H,14,16) |
| InChIKey | LYLXONHCCRZGPQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|