C13H22N4O2 — CID 106665853
3-(3-methoxy-3-methylbutoxy)-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 106665853) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(3-methoxy-3-methylbutoxy)-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-(3-methoxy-3-methylbutoxy)-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 106665853 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-(3-methoxy-3-methylbutoxy)-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(OCCC(C)(C)OC)nnc(C)c1C |
| InChI | InChI=1S/C13H22N4O2/c1-8-9(2)16-17-12(10(8)11(14)15)19-7-6-13(3,4)18-5/h6-7H2,1-5H3,(H3,14,15) |
| InChIKey | QIGBTYHVTNGNAW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|