C15H18N4O2 — CID 61090301
3-[(3-methoxyphenyl)methoxy]-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 61090301) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methoxy]-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-[(3-methoxyphenyl)methoxy]-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 61090301 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-[(3-methoxyphenyl)methoxy]-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(OCc2cccc(OC)c2)nnc(C)c1C |
| InChI | InChI=1S/C15H18N4O2/c1-9-10(2)18-19-15(13(9)14(16)17)21-8-11-5-4-6-12(7-11)20-3/h4-7H,8H2,1-3H3,(H3,16,17) |
| InChIKey | KYNWAGXJBSWXCD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|