C13H22N4O — CID 61092166
3-hexoxy-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 61092166) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-hexoxy-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-hexoxy-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 61092166 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-hexoxy-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(OCCCCCC)nnc(C)c1C |
| InChI | InChI=1S/C13H22N4O/c1-4-5-6-7-8-18-13-11(12(14)15)9(2)10(3)16-17-13/h4-8H2,1-3H3,(H3,14,15) |
| InChIKey | QQQFFVDMBSMLPW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|