C13H23N3O — CID 61097427
(3-hexoxy-5,6-dimethylpyridazin-4-yl)methanamine (PubChem CID 61097427) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is (3-hexoxy-5,6-dimethylpyridazin-4-yl)methanamine.
| Compound Name | (3-hexoxy-5,6-dimethylpyridazin-4-yl)methanamine |
|---|---|
| PubChem CID | 61097427 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (3-hexoxy-5,6-dimethylpyridazin-4-yl)methanamine |
| SMILES | CCCCCCOc1nnc(C)c(C)c1CN |
| InChI | InChI=1S/C13H23N3O/c1-4-5-6-7-8-17-13-12(9-14)10(2)11(3)15-16-13/h4-9,14H2,1-3H3 |
| InChIKey | CDMMDWHMYLIJAY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|