C13H23N3O2 — CID 61097023
[3-(2-butoxyethoxy)-5,6-dimethylpyridazin-4-yl]methanamine (PubChem CID 61097023) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is [3-(2-butoxyethoxy)-5,6-dimethylpyridazin-4-yl]methanamine.
| Compound Name | [3-(2-butoxyethoxy)-5,6-dimethylpyridazin-4-yl]methanamine |
|---|---|
| PubChem CID | 61097023 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | [3-(2-butoxyethoxy)-5,6-dimethylpyridazin-4-yl]methanamine |
| SMILES | CCCCOCCOc1nnc(C)c(C)c1CN |
| InChI | InChI=1S/C13H23N3O2/c1-4-5-6-17-7-8-18-13-12(9-14)10(2)11(3)15-16-13/h4-9,14H2,1-3H3 |
| InChIKey | SCYDWEZGKHNJMF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|