C15H24N2O4 — CID 80515523
3-(2-butoxyethoxy)-5,6-diethylpyridazine-4-carboxylic acid (PubChem CID 80515523) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(2-butoxyethoxy)-5,6-diethylpyridazine-4-carboxylic acid.
| Compound Name | 3-(2-butoxyethoxy)-5,6-diethylpyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80515523 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(2-butoxyethoxy)-5,6-diethylpyridazine-4-carboxylic acid |
| SMILES | CCCCOCCOc1nnc(CC)c(CC)c1C(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-4-7-8-20-9-10-21-14-13(15(18)19)11(5-2)12(6-3)16-17-14/h4-10H2,1-3H3,(H,18,19) |
| InChIKey | VFEMBVCDJHUANN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|