C13H11Cl3N4O — CID 61092542
5,6-dimethyl-3-(2,4,5-trichlorophenoxy)pyridazine-4-carboximidamide (PubChem CID 61092542) has the molecular formula C13H11Cl3N4O and a molecular weight of 345.62 g/mol. Its IUPAC name is 5,6-dimethyl-3-(2,4,5-trichlorophenoxy)pyridazine-4-carboximidamide.
| Compound Name | 5,6-dimethyl-3-(2,4,5-trichlorophenoxy)pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 61092542 |
| Molecular Formula | C13H11Cl3N4O |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 5,6-dimethyl-3-(2,4,5-trichlorophenoxy)pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(Oc2cc(Cl)c(Cl)cc2Cl)nnc(C)c1C |
| InChI | InChI=1S/C13H11Cl3N4O/c1-5-6(2)19-20-13(11(5)12(17)18)21-10-4-8(15)7(14)3-9(10)16/h3-4H,1-2H3,(H3,17,18) |
| InChIKey | AHNWZTKQSJNLBM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|