C17H19ClN4O3 — CID 10270044
ethyl 4-[3-[(2-amino-6-chloro-4-pyridinyl)amino]propanoylamino]benzoate (PubChem CID 10270044) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is ethyl 4-[3-[(2-amino-6-chloro-4-pyridinyl)amino]propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-[(2-amino-6-chloro-4-pyridinyl)amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 10270044 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | ethyl 4-[3-[(2-amino-6-chloro-4-pyridinyl)amino]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCNc2cc(N)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-2-25-17(24)11-3-5-12(6-4-11)21-16(23)7-8-20-13-9-14(18)22-15(19)10-13/h3-6,9-10H,2,7-8H2,1H3,(H,21,23)(H3,19,20,22) |
| InChIKey | QFCSFOOMVMFZIE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|