C13H17NO4S2 — CID 102701278
2-(hydroxymethyl)-N-(2-methoxypropyl)-1-benzothiophene-3-sulfonamide (PubChem CID 102701278) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-(2-methoxypropyl)-1-benzothiophene-3-sulfonamide.
| Compound Name | 2-(hydroxymethyl)-N-(2-methoxypropyl)-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102701278 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(hydroxymethyl)-N-(2-methoxypropyl)-1-benzothiophene-3-sulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1c(CO)sc2ccccc12 |
| InChI | InChI=1S/C13H17NO4S2/c1-9(18-2)7-14-20(16,17)13-10-5-3-4-6-11(10)19-12(13)8-15/h3-6,9,14-15H,7-8H2,1-2H3 |
| InChIKey | JSEIMBLJNCJNOZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |