C16H23N5 — CID 102706366
5-[1-(1-cyclopentylethyl)tetrazol-5-yl]-2,4-dimethylaniline (PubChem CID 102706366) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-[1-(1-cyclopentylethyl)tetrazol-5-yl]-2,4-dimethylaniline.
| Compound Name | 5-[1-(1-cyclopentylethyl)tetrazol-5-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 102706366 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 5-[1-(1-cyclopentylethyl)tetrazol-5-yl]-2,4-dimethylaniline |
| SMILES | Cc1cc(C)c(-c2nnnn2C(C)C2CCCC2)cc1N |
| InChI | InChI=1S/C16H23N5/c1-10-8-11(2)15(17)9-14(10)16-18-19-20-21(16)12(3)13-6-4-5-7-13/h8-9,12-13H,4-7,17H2,1-3H3 |
| InChIKey | IELFHXFGAADLTB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|