C16H23N5 — CID 102706381
2,4-dimethyl-5-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline (PubChem CID 102706381) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2,4-dimethyl-5-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline.
| Compound Name | 2,4-dimethyl-5-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 102706381 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2,4-dimethyl-5-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline |
| SMILES | Cc1cc(C)c(-c2nnnn2C2C(C)(C)C2(C)C)cc1N |
| InChI | InChI=1S/C16H23N5/c1-9-7-10(2)12(17)8-11(9)13-18-19-20-21(13)14-15(3,4)16(14,5)6/h7-8,14H,17H2,1-6H3 |
| InChIKey | DOWBVFZMRIEETN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|