C14H18FN5 — CID 79362712
4-fluoro-3-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline (PubChem CID 79362712) has the molecular formula C14H18FN5 and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-fluoro-3-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline.
| Compound Name | 4-fluoro-3-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 79362712 |
| Molecular Formula | C14H18FN5 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-fluoro-3-[1-(2,2,3,3-tetramethylcyclopropyl)tetrazol-5-yl]aniline |
| SMILES | CC1(C)C(n2nnnc2-c2cc(N)ccc2F)C1(C)C |
| InChI | InChI=1S/C14H18FN5/c1-13(2)12(14(13,3)4)20-11(17-18-19-20)9-7-8(16)5-6-10(9)15/h5-7,12H,16H2,1-4H3 |
| InChIKey | VUHMSYLBQNMVHS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|