C14H19N5O2 — CID 102706333
5-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]-2,4-dimethylaniline (PubChem CID 102706333) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]-2,4-dimethylaniline.
| Compound Name | 5-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 102706333 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 5-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]-2,4-dimethylaniline |
| SMILES | Cc1cc(C)c(-c2nnnn2CC2COCCO2)cc1N |
| InChI | InChI=1S/C14H19N5O2/c1-9-5-10(2)13(15)6-12(9)14-16-17-18-19(14)7-11-8-20-3-4-21-11/h5-6,11H,3-4,7-8,15H2,1-2H3 |
| InChIKey | XDOXQJAGKWYAFP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|