C12H15N5O2 — CID 61351622
3-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]aniline (PubChem CID 61351622) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]aniline.
| Compound Name | 3-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 61351622 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-[1-(1,4-dioxan-2-ylmethyl)tetrazol-5-yl]aniline |
| SMILES | Nc1cccc(-c2nnnn2CC2COCCO2)c1 |
| InChI | InChI=1S/C12H15N5O2/c13-10-3-1-2-9(6-10)12-14-15-16-17(12)7-11-8-18-4-5-19-11/h1-3,6,11H,4-5,7-8,13H2 |
| InChIKey | NEDBTZFIJCMEBO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|