C13H17N5 — CID 114109267
3-[1-[(2,2-dimethylcyclopropyl)methyl]tetrazol-5-yl]aniline (PubChem CID 114109267) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-[1-[(2,2-dimethylcyclopropyl)methyl]tetrazol-5-yl]aniline.
| Compound Name | 3-[1-[(2,2-dimethylcyclopropyl)methyl]tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 114109267 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-[1-[(2,2-dimethylcyclopropyl)methyl]tetrazol-5-yl]aniline |
| SMILES | CC1(C)CC1Cn1nnnc1-c1cccc(N)c1 |
| InChI | InChI=1S/C13H17N5/c1-13(2)7-10(13)8-18-12(15-16-17-18)9-4-3-5-11(14)6-9/h3-6,10H,7-8,14H2,1-2H3 |
| InChIKey | GXQGMJRUBGWZRN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|