C7H11ClN4O2 — CID 62735881
5-(chloromethyl)-1-(1,4-dioxan-2-ylmethyl)tetrazole (PubChem CID 62735881) has the molecular formula C7H11ClN4O2 and a molecular weight of 218.64 g/mol. Its IUPAC name is 5-(chloromethyl)-1-(1,4-dioxan-2-ylmethyl)tetrazole.
| Compound Name | 5-(chloromethyl)-1-(1,4-dioxan-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 62735881 |
| Molecular Formula | C7H11ClN4O2 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-(chloromethyl)-1-(1,4-dioxan-2-ylmethyl)tetrazole |
| SMILES | ClCc1nnnn1CC1COCCO1 |
| InChI | InChI=1S/C7H11ClN4O2/c8-3-7-9-10-11-12(7)4-6-5-13-1-2-14-6/h6H,1-5H2 |
| InChIKey | WHNIKPBWUYGNDT-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|