C13H17N5O2 — CID 104784567
2-methoxy-4-[1-(oxolan-3-ylmethyl)tetrazol-5-yl]aniline (PubChem CID 104784567) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-methoxy-4-[1-(oxolan-3-ylmethyl)tetrazol-5-yl]aniline.
| Compound Name | 2-methoxy-4-[1-(oxolan-3-ylmethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 104784567 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-methoxy-4-[1-(oxolan-3-ylmethyl)tetrazol-5-yl]aniline |
| SMILES | COc1cc(-c2nnnn2CC2CCOC2)ccc1N |
| InChI | InChI=1S/C13H17N5O2/c1-19-12-6-10(2-3-11(12)14)13-15-16-17-18(13)7-9-4-5-20-8-9/h2-3,6,9H,4-5,7-8,14H2,1H3 |
| InChIKey | SDGZYNBLMUFYQP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|