C13H17F3N2 — CID 102708274
N-[(2-methylcyclopropyl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine (PubChem CID 102708274) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is N-[(2-methylcyclopropyl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[(2-methylcyclopropyl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102708274 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N-[(2-methylcyclopropyl)-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNC(c1cnccc1C(F)(F)F)C1CC1C |
| InChI | InChI=1S/C13H17F3N2/c1-3-18-12(9-6-8(9)2)10-7-17-5-4-11(10)13(14,15)16/h4-5,7-9,12,18H,3,6H2,1-2H3 |
| InChIKey | GBLZBGQMJYKTHU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |