C11H12F3N5 — CID 102708410
N-[2H-triazol-4-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine (PubChem CID 102708410) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is N-[2H-triazol-4-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[2H-triazol-4-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102708410 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[2H-triazol-4-yl-[4-(trifluoromethyl)-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNC(c1cn[nH]n1)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3N5/c1-2-16-10(9-6-17-19-18-9)7-5-15-4-3-8(7)11(12,13)14/h3-6,10,16H,2H2,1H3,(H,17,18,19) |
| InChIKey | XEKQLUBPNOTLIJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |