C13H13ClF3N3 — CID 102716261
2-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine (PubChem CID 102716261) has the molecular formula C13H13ClF3N3 and a molecular weight of 303.72 g/mol. Its IUPAC name is 2-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 102716261 |
| Molecular Formula | C13H13ClF3N3 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-chloro-6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine |
| SMILES | CCc1c(C)nn(-c2cc(C(F)(F)F)cc(Cl)n2)c1C |
| InChI | InChI=1S/C13H13ClF3N3/c1-4-10-7(2)19-20(8(10)3)12-6-9(13(15,16)17)5-11(14)18-12/h5-6H,4H2,1-3H3 |
| InChIKey | ROZFOECTEZSFKY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|