C11H8Cl2F3N3 — CID 102716265
2-chloro-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine (PubChem CID 102716265) has the molecular formula C11H8Cl2F3N3 and a molecular weight of 310.11 g/mol. Its IUPAC name is 2-chloro-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 102716265 |
| Molecular Formula | C11H8Cl2F3N3 |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-chloro-6-(4-chloro-3,5-dimethylpyrazol-1-yl)-4-(trifluoromethyl)pyridine |
| SMILES | Cc1nn(-c2cc(C(F)(F)F)cc(Cl)n2)c(C)c1Cl |
| InChI | InChI=1S/C11H8Cl2F3N3/c1-5-10(13)6(2)19(18-5)9-4-7(11(14,15)16)3-8(12)17-9/h3-4H,1-2H3 |
| InChIKey | SKXCXIPFOJNRIE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|