C12H11ClF3N3 — CID 66020937
2-(5-chloro-4-ethyl-3-methylpyrazol-1-yl)-5-(trifluoromethyl)pyridine (PubChem CID 66020937) has the molecular formula C12H11ClF3N3 and a molecular weight of 289.69 g/mol. Its IUPAC name is 2-(5-chloro-4-ethyl-3-methylpyrazol-1-yl)-5-(trifluoromethyl)pyridine.
| Compound Name | 2-(5-chloro-4-ethyl-3-methylpyrazol-1-yl)-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 66020937 |
| Molecular Formula | C12H11ClF3N3 |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(5-chloro-4-ethyl-3-methylpyrazol-1-yl)-5-(trifluoromethyl)pyridine |
| SMILES | CCc1c(C)nn(-c2ccc(C(F)(F)F)cn2)c1Cl |
| InChI | InChI=1S/C12H11ClF3N3/c1-3-9-7(2)18-19(11(9)13)10-5-4-8(6-17-10)12(14,15)16/h4-6H,3H2,1-2H3 |
| InChIKey | VGKNDGLZAFYPAO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |