C13H10Cl2F3N3 — CID 63353595
2-[5-chloro-4-(chloromethyl)-3-cyclopropylpyrazol-1-yl]-5-(trifluoromethyl)pyridine (PubChem CID 63353595) has the molecular formula C13H10Cl2F3N3 and a molecular weight of 336.14 g/mol. Its IUPAC name is 2-[5-chloro-4-(chloromethyl)-3-cyclopropylpyrazol-1-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 2-[5-chloro-4-(chloromethyl)-3-cyclopropylpyrazol-1-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 63353595 |
| Molecular Formula | C13H10Cl2F3N3 |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-[5-chloro-4-(chloromethyl)-3-cyclopropylpyrazol-1-yl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(-n2nc(C3CC3)c(CCl)c2Cl)nc1 |
| InChI | InChI=1S/C13H10Cl2F3N3/c14-5-9-11(7-1-2-7)20-21(12(9)15)10-4-3-8(6-19-10)13(16,17)18/h3-4,6-7H,1-2,5H2 |
| InChIKey | GUYNXPFXTKIJRZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|