C14H15F3N4 — CID 83205345
3-cyclopentyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine (PubChem CID 83205345) has the molecular formula C14H15F3N4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-cyclopentyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine.
| Compound Name | 3-cyclopentyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 83205345 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-cyclopentyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-amine |
| SMILES | Nc1cn(-c2ccc(C(F)(F)F)cn2)nc1C1CCCC1 |
| InChI | InChI=1S/C14H15F3N4/c15-14(16,17)10-5-6-12(19-7-10)21-8-11(18)13(20-21)9-3-1-2-4-9/h5-9H,1-4,18H2 |
| InChIKey | FPYJUIJOKCQXHA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |