C14H12F3N5O — CID 22310061
5-amino-3-(oxolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonitrile (PubChem CID 22310061) has the molecular formula C14H12F3N5O and a molecular weight of 323.28 g/mol. Its IUPAC name is 5-amino-3-(oxolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(oxolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 22310061 |
| Molecular Formula | C14H12F3N5O |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-amino-3-(oxolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(C2CCCO2)nn(-c2ccc(C(F)(F)F)cn2)c1N |
| InChI | InChI=1S/C14H12F3N5O/c15-14(16,17)8-3-4-11(20-7-8)22-13(19)9(6-18)12(21-22)10-2-1-5-23-10/h3-4,7,10H,1-2,5,19H2 |
| InChIKey | VAOXQLGVHQAVOM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |