C21H19N3O3S — CID 10271900
3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-pyridin-4-ylethyl)urea (PubChem CID 10271900) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-pyridin-4-ylethyl)urea.
| Compound Name | 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-pyridin-4-ylethyl)urea |
|---|---|
| PubChem CID | 10271900 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-pyridin-4-ylethyl)urea |
| SMILES | CN(CCc1ccncc1)C(=O)Nc1ccc2c(c1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C21H19N3O3S/c1-24(13-10-15-8-11-22-12-9-15)21(25)23-16-6-7-20-18(14-16)17-4-2-3-5-19(17)28(20,26)27/h2-9,11-12,14H,10,13H2,1H3,(H,23,25) |
| InChIKey | ZJUCPWQLZWASHS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |