C22H20N2O3S — CID 10157350
3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-phenylethyl)urea (PubChem CID 10157350) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-phenylethyl)urea.
| Compound Name | 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 10157350 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-(5,5-dioxodibenzothiophen-2-yl)-1-methyl-1-(2-phenylethyl)urea |
| SMILES | CN(CCc1ccccc1)C(=O)Nc1ccc2c(c1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C22H20N2O3S/c1-24(14-13-16-7-3-2-4-8-16)22(25)23-17-11-12-21-19(15-17)18-9-5-6-10-20(18)28(21,26)27/h2-12,15H,13-14H2,1H3,(H,23,25) |
| InChIKey | DQNZPEKGFSRDBX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |