C8H5F6NO4 — CID 102721456
5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 102721456) has the molecular formula C8H5F6NO4 and a molecular weight of 293.12 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 102721456 |
| Molecular Formula | C8H5F6NO4 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(COC(C(F)(F)F)C(F)(F)F)on1 |
| InChI | InChI=1S/C8H5F6NO4/c9-7(10,11)6(8(12,13)14)18-2-3-1-4(5(16)17)15-19-3/h1,6H,2H2,(H,16,17) |
| InChIKey | IHGGOAIVKQFFRT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |