C13H13F6NO — CID 102721910
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 102721910) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 102721910 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CNC1c2ccccc2CC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO/c1-20-10-8-5-3-2-4-7(8)6-9(10)21-11(12(14,15)16)13(17,18)19/h2-5,9-11,20H,6H2,1H3 |
| InChIKey | YRABSSOULGKXSX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |