C13H13F6NO — CID 102721883
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 102721883) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 102721883 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | NC1c2ccccc2CCC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO/c14-12(15,16)11(13(17,18)19)21-9-6-5-7-3-1-2-4-8(7)10(9)20/h1-4,9-11H,5-6,20H2 |
| InChIKey | YRNDQUAYJLRSPE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |