C8H13F6NO — CID 102721983
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-2-amine (PubChem CID 102721983) has the molecular formula C8H13F6NO and a molecular weight of 253.19 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-2-amine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-2-amine |
|---|---|
| PubChem CID | 102721983 |
| Molecular Formula | C8H13F6NO |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)pentan-2-amine |
| SMILES | CC(N)CC(C)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO/c1-4(15)3-5(2)16-6(7(9,10)11)8(12,13)14/h4-6H,3,15H2,1-2H3 |
| InChIKey | NMAAREXWECEBJN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |