C10H13F6NO — CID 102722175
5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylpentanenitrile (PubChem CID 102722175) has the molecular formula C10H13F6NO and a molecular weight of 277.21 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 102722175 |
| Molecular Formula | C10H13F6NO |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F6NO/c1-8(2,6-17)4-3-5-18-7(9(11,12)13)10(14,15)16/h7H,3-5H2,1-2H3 |
| InChIKey | GXIWSXWKCNUZRI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|