C10H6ClF6NOS — CID 102722204
5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)benzenecarbothioamide (PubChem CID 102722204) has the molecular formula C10H6ClF6NOS and a molecular weight of 337.67 g/mol. Its IUPAC name is 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 102722204 |
| Molecular Formula | C10H6ClF6NOS |
| Molecular Weight | 337.67 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 5-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)ccc1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF6NOS/c11-4-1-2-6(5(3-4)7(18)20)19-8(9(12,13)14)10(15,16)17/h1-3,8H,(H2,18,20) |
| InChIKey | BXQXRIDPRBSMCF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.67 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|