C9H7ClF6N2O — CID 102722607
5-(chloromethyl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-methylpyrimidine (PubChem CID 102722607) has the molecular formula C9H7ClF6N2O and a molecular weight of 308.61 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-methylpyrimidine.
| Compound Name | 5-(chloromethyl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-methylpyrimidine |
|---|---|
| PubChem CID | 102722607 |
| Molecular Formula | C9H7ClF6N2O |
| Molecular Weight | 308.61 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-(chloromethyl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-methylpyrimidine |
| SMILES | Cc1nc(OC(C(F)(F)F)C(F)(F)F)ncc1CCl |
| InChI | InChI=1S/C9H7ClF6N2O/c1-4-5(2-10)3-17-7(18-4)19-6(8(11,12)13)9(14,15)16/h3,6H,2H2,1H3 |
| InChIKey | AYZXXPYNHKUDPC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|