C9H10F6N2O2 — CID 102723207
1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazol-3-yl]-N-methylmethanamine (PubChem CID 102723207) has the molecular formula C9H10F6N2O2 and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 102723207 |
| Molecular Formula | C9H10F6N2O2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-1,2-oxazol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(COC(C(F)(F)F)C(F)(F)F)on1 |
| InChI | InChI=1S/C9H10F6N2O2/c1-16-3-5-2-6(19-17-5)4-18-7(8(10,11)12)9(13,14)15/h2,7,16H,3-4H2,1H3 |
| InChIKey | UDNQJXMCKFGHIV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |