C17H32N2S — CID 102725709
[3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4-dimethylthian-3-yl]methanamine (PubChem CID 102725709) has the molecular formula C17H32N2S and a molecular weight of 296.52 g/mol. Its IUPAC name is [3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4-dimethylthian-3-yl]methanamine.
| Compound Name | [3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4-dimethylthian-3-yl]methanamine |
|---|---|
| PubChem CID | 102725709 |
| Molecular Formula | C17H32N2S |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | [3-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4-dimethylthian-3-yl]methanamine |
| SMILES | CC1(C)CCSCC1(CN)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H32N2S/c1-16(2)9-11-20-13-17(16,12-18)19-10-5-7-14-6-3-4-8-15(14)19/h14-15H,3-13,18H2,1-2H3/t14-,15-,17?/m1/s1 |
| InChIKey | WUWNUTIZKBSKPC-BLBXNVQISA-N |
| XLogP | 3.50 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |