C14H26N2S — CID 79950832
[3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-methylthiolan-3-yl]methanamine (PubChem CID 79950832) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-methylthiolan-3-yl]methanamine.
| Compound Name | [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-methylthiolan-3-yl]methanamine |
|---|---|
| PubChem CID | 79950832 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | [3-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-5-methylthiolan-3-yl]methanamine |
| SMILES | CC1CC(CN)(N2CCCC3CCCC32)CS1 |
| InChI | InChI=1S/C14H26N2S/c1-11-8-14(9-15,10-17-11)16-7-3-5-12-4-2-6-13(12)16/h11-13H,2-10,15H2,1H3 |
| InChIKey | VZGPGCBINGOEIM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |