C17H33N3 — CID 102725752
[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-ethylpiperidin-4-yl]methanamine (PubChem CID 102725752) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is [4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-ethylpiperidin-4-yl]methanamine.
| Compound Name | [4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-ethylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 102725752 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | [4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-ethylpiperidin-4-yl]methanamine |
| SMILES | CCN1CCC(CN)(N2CCC[C@H]3CCCC[C@H]32)CC1 |
| InChI | InChI=1S/C17H33N3/c1-2-19-12-9-17(14-18,10-13-19)20-11-5-7-15-6-3-4-8-16(15)20/h15-16H,2-14,18H2,1H3/t15-,16-/m1/s1 |
| InChIKey | AMDURKNBLJAMJR-HZPDHXFCSA-N |
| XLogP | 2.45 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |