C17H34N4 — CID 81199467
[1-ethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)piperidin-4-yl]methanamine (PubChem CID 81199467) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is [1-ethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)piperidin-4-yl]methanamine.
| Compound Name | [1-ethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 81199467 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | [1-ethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)piperidin-4-yl]methanamine |
| SMILES | CCN1CCC(CN)(N2CCC3C(CCCN3C)C2)CC1 |
| InChI | InChI=1S/C17H34N4/c1-3-20-11-7-17(14-18,8-12-20)21-10-6-16-15(13-21)5-4-9-19(16)2/h15-16H,3-14,18H2,1-2H3 |
| InChIKey | ROWZPRGGZVCGNA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |