C17H33N3O — CID 81199448
[2,2-dimethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)oxan-4-yl]methanamine (PubChem CID 81199448) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is [2,2-dimethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)oxan-4-yl]methanamine.
| Compound Name | [2,2-dimethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 81199448 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | [2,2-dimethyl-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)oxan-4-yl]methanamine |
| SMILES | CN1CCCC2CN(C3(CN)CCOC(C)(C)C3)CCC21 |
| InChI | InChI=1S/C17H33N3O/c1-16(2)12-17(13-18,7-10-21-16)20-9-6-15-14(11-20)5-4-8-19(15)3/h14-15H,4-13,18H2,1-3H3 |
| InChIKey | GXVPPXZHRVKNJH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |