C24H27N3O3 — CID 10272647
N-(cyanomethyl)-2-(cyclohexylmethyl)-N'-(3-phenoxyphenyl)propanediamide (PubChem CID 10272647) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(cyclohexylmethyl)-N'-(3-phenoxyphenyl)propanediamide.
| Compound Name | N-(cyanomethyl)-2-(cyclohexylmethyl)-N'-(3-phenoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 10272647 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-(cyanomethyl)-2-(cyclohexylmethyl)-N'-(3-phenoxyphenyl)propanediamide |
| SMILES | N#CCNC(=O)C(CC1CCCCC1)C(=O)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O3/c25-14-15-26-23(28)22(16-18-8-3-1-4-9-18)24(29)27-19-10-7-13-21(17-19)30-20-11-5-2-6-12-20/h2,5-7,10-13,17-18,22H,1,3-4,8-9,15-16H2,(H,26,28)(H,27,29) |
| InChIKey | ULPMNILFDQBFDH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|