C16H26FN3O3 — CID 102730346
tert-butyl N-[4-amino-3-(2-fluoro-5-methoxyanilino)butyl]carbamate (PubChem CID 102730346) has the molecular formula C16H26FN3O3 and a molecular weight of 327.40 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(2-fluoro-5-methoxyanilino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(2-fluoro-5-methoxyanilino)butyl]carbamate |
|---|---|
| PubChem CID | 102730346 |
| Molecular Formula | C16H26FN3O3 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl N-[4-amino-3-(2-fluoro-5-methoxyanilino)butyl]carbamate |
| SMILES | COc1ccc(F)c(NC(CN)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H26FN3O3/c1-16(2,3)23-15(21)19-8-7-11(10-18)20-14-9-12(22-4)5-6-13(14)17/h5-6,9,11,20H,7-8,10,18H2,1-4H3,(H,19,21) |
| InChIKey | JRPNGKGLMKELRT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |