C16H26BrN3O2 — CID 102730390
tert-butyl N-[4-amino-3-(2-bromo-5-methylanilino)butyl]carbamate (PubChem CID 102730390) has the molecular formula C16H26BrN3O2 and a molecular weight of 372.31 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(2-bromo-5-methylanilino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(2-bromo-5-methylanilino)butyl]carbamate |
|---|---|
| PubChem CID | 102730390 |
| Molecular Formula | C16H26BrN3O2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl N-[4-amino-3-(2-bromo-5-methylanilino)butyl]carbamate |
| SMILES | Cc1ccc(Br)c(NC(CN)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H26BrN3O2/c1-11-5-6-13(17)14(9-11)20-12(10-18)7-8-19-15(21)22-16(2,3)4/h5-6,9,12,20H,7-8,10,18H2,1-4H3,(H,19,21) |
| InChIKey | LEEPARZTTXSMKL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |