C13H29N3O3 — CID 102730417
tert-butyl N-[4-amino-3-(4-hydroxybutan-2-ylamino)butan-2-yl]carbamate (PubChem CID 102730417) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(4-hydroxybutan-2-ylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(4-hydroxybutan-2-ylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102730417 |
| Molecular Formula | C13H29N3O3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | tert-butyl N-[4-amino-3-(4-hydroxybutan-2-ylamino)butan-2-yl]carbamate |
| SMILES | CC(CCO)NC(CN)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H29N3O3/c1-9(6-7-17)15-11(8-14)10(2)16-12(18)19-13(3,4)5/h9-11,15,17H,6-8,14H2,1-5H3,(H,16,18) |
| InChIKey | IIPJAQWAZCQLBG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |