C14H31N3O3 — CID 102730361
tert-butyl N-[4-amino-3-(5-hydroxypentan-2-ylamino)butan-2-yl]carbamate (PubChem CID 102730361) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(5-hydroxypentan-2-ylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(5-hydroxypentan-2-ylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102730361 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | tert-butyl N-[4-amino-3-(5-hydroxypentan-2-ylamino)butan-2-yl]carbamate |
| SMILES | CC(CCCO)NC(CN)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H31N3O3/c1-10(7-6-8-18)16-12(9-15)11(2)17-13(19)20-14(3,4)5/h10-12,16,18H,6-9,15H2,1-5H3,(H,17,19) |
| InChIKey | IIMPRZZUOMJJHP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |