C11H25N3O2 — CID 102729964
tert-butyl N-[4-amino-3-(ethylamino)butan-2-yl]carbamate (PubChem CID 102729964) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(ethylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(ethylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102729964 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | tert-butyl N-[4-amino-3-(ethylamino)butan-2-yl]carbamate |
| SMILES | CCNC(CN)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-6-13-9(7-12)8(2)14-10(15)16-11(3,4)5/h8-9,13H,6-7,12H2,1-5H3,(H,14,15) |
| InChIKey | LLCICIYVCOJWSY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |