About 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one
4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one (PubChem CID 102738878) has the molecular formula C14H21ClN4O
and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one |
| PubChem CID | 102738878 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one |
| SMILES | N[C@@H]1CCCC[C@H]1Nc1c(Cl)cnn(CC2CC2)c1=O |
| InChI | InChI=1S/C14H21ClN4O/c15-10-7-17-19(8-9-5-6-9)14(20)13(10)18-12-4-2-1-3-11(12)16/h7,9,11-12,18H,1-6,8,16H2/t11-,12-/m1/s1 |
| InChIKey | BWNYSPSDCHIVCQ-VXGBXAGGSA-N |
| XLogP | 1.99 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one?
The IUPAC name of 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one (CID 102738878) is 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one.
What is the SMILES notation for 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one?
The canonical SMILES for 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one is N[C@@H]1CCCC[C@H]1Nc1c(Cl)cnn(CC2CC2)c1=O.
What is the InChIKey of 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one?
The InChIKey is BWNYSPSDCHIVCQ-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H21ClN4O/c15-10-7-17-19(8-9-5-6-9)14(20)13(10)18-12-4-2-1-3-11(12)16/h7,9,11-12,18H,1-6,8,16H2/t11-,12-/m1/s1.
What are the key properties of 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one?
4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one has a molecular weight of 296.80 g/mol, XLogP of 1.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,2R)-2-aminocyclohexyl]amino]-5-chloro-2-(cyclopropylmethyl)pyridazin-3-one is sourced from PubChem (CID 102738878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).